CAS 1247503-48-5 appears in our catalog under these names: 6–(2,2,2–Trifluoroethoxy)picolinic acid, 6-(2,2,2-Trifluoroethoxy)picolinic acid, 6-(2,2,2-Trifluoroethoxy)pyridine-2-carboxylic acid, 95%, 95%, 6-(2,2,2-Trifluoroethoxy)pyridine-2-carboxylic acid, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 0,5g, 10g.
6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid (CAS 1247503-48-5) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid. InChIKey: ANLJLNWTEWVWCP-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid |
| InChIKey | ANLJLNWTEWVWCP-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)OCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)