cas: 1188539-34-5 — see every product listed under this CAS number, including other names
6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)furo[3,2-b]pyridine 97% (CAS 1188539-34-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A209531-1g |
| cas | 1188539-34-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 3735.69 Pln | |
| Ambeed | 50mg | 804.25 Pln | |
| Ambeed | 100mg | 948.88 Pln | |
| Ambeed | 250mg | 1538.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A209531 |
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[3,2-b]pyridine (CAS 1188539-34-5) is a chemical compound with the molecular formula C13H16BNO3 and a molecular weight of 245.08 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[3,2-b]pyridine. InChIKey: GSSJAXUDJLCMNO-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO3 |
|---|---|
| Molecular weight | 245.08 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[3,2-b]pyridine |
| InChIKey | GSSJAXUDJLCMNO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=CO3)N=C2 |
Computed by PubChem (NCBI)