cas: 40542-90-3 — see every product listed under this CAS number, including other names
6-(Benzyloxy)-6-oxohexanoic acid 97% (CAS 40542-90-3) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100565-500g |
| cas | 40542-90-3 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 15155.50 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 1037.88 Pln | |
| Ambeed | 100g | 3841.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A100565 |
6-oxo-6-phenylmethoxyhexanoic acid (CAS 40542-90-3) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: 6-oxo-6-phenylmethoxyhexanoic acid. InChIKey: CQSWISNVQPOAEM-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 6-oxo-6-phenylmethoxyhexanoic acid |
| InChIKey | CQSWISNVQPOAEM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCCCC(=O)O |
Computed by PubChem (NCBI)