cas: 1951439-77-2 — see every product listed under this CAS number, including other names
6-(Boc-amino)-3-azabicyclo[3.1.0]hexane hcl, 97%, 97% (CAS 1951439-77-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I47T-100mg |
| cas | 1951439-77-2 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1062.80 Pln | |
| Chemat | 250mg | 1658.00 Pln | |
| Chemat | 500mg | 2723.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(3-azabicyclo[3.1.0]hexan-6-yl)carbamate;hydrochloride (CAS 1951439-77-2) is a chemical compound with the molecular formula C10H19ClN2O2 and a molecular weight of 234.72 g/mol. IUPAC name: tert-butyl N-(3-azabicyclo[3.1.0]hexan-6-yl)carbamate;hydrochloride. InChIKey: IFRQZAIOWPIKAN-UHFFFAOYSA-N.
| Molecular formula | C10H19ClN2O2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | tert-butyl N-(3-azabicyclo[3.1.0]hexan-6-yl)carbamate;hydrochloride |
| InChIKey | IFRQZAIOWPIKAN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1C2C1CNC2.Cl |
Computed by PubChem (NCBI)