CAS 2007925-04-2 appears in our catalog under these names: tert-Butyl 1-amino-5-azaspiro[2.3]hexane-5-carboxylate hydrochloride, 95%, tert-Butyl 1-amino-5-azaspiro[2.3]hexane-5-carboxylate hydrochloride, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 100mg, 5g, 1g, 250mg, 500mg.
Tert-butyl 2-amino-5-azaspiro[2.3]hexane-5-carboxylate;hydrochloride (CAS 2007925-04-2) is a chemical compound with the molecular formula C10H19ClN2O2 and a molecular weight of 234.72 g/mol. IUPAC name: tert-butyl 2-amino-5-azaspiro[2.3]hexane-5-carboxylate;hydrochloride. InChIKey: CCBAPUSJIOYYHH-UHFFFAOYSA-N.
| Molecular formula | C10H19ClN2O2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | tert-butyl 2-amino-5-azaspiro[2.3]hexane-5-carboxylate;hydrochloride |
| InChIKey | CCBAPUSJIOYYHH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC2N.Cl |
Computed by PubChem (NCBI)