CAS 1955556-99-6 appears in our catalog under these names: tert-butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate hydrochloride, 95%, tert-Butyl 1,6-diazaspiro(3.3)heptane-6-carboxylate hydrochloride, 95%, tert-butyl 1,6-diazaspiro(3.3)heptane-6-carboxylate hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g, 100mg.
Tert-butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate;hydrochloride (CAS 1955556-99-6) is a chemical compound with the molecular formula C10H19ClN2O2 and a molecular weight of 234.72 g/mol. IUPAC name: tert-butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate;hydrochloride. InChIKey: BZSBJGQPTYWKOW-UHFFFAOYSA-N.
| Molecular formula | C10H19ClN2O2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | tert-butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate;hydrochloride |
| InChIKey | BZSBJGQPTYWKOW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCN2.Cl |
Computed by PubChem (NCBI)