CAS 2306246-64-8 appears in our catalog under these names: tert-Butyl (1r,5r)-3,6-diazabicyclo[3.2.0]heptane-3-carboxylate hydrochloride, 95%, tert-Butyl (1R,5R)-3,6-diazabicyclo(3.2.0)heptane-3-carboxylate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl (1R,5R)-3,6-diazabicyclo[3.2.0]heptane-3-carboxylate;hydrochloride (CAS 2306246-64-8) is a chemical compound with the molecular formula C10H19ClN2O2 and a molecular weight of 234.72 g/mol. IUPAC name: tert-butyl (1R,5R)-3,6-diazabicyclo[3.2.0]heptane-3-carboxylate;hydrochloride. InChIKey: CTVDRVRVOABUPB-WLYNEOFISA-N.
| Molecular formula | C10H19ClN2O2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | tert-butyl (1R,5R)-3,6-diazabicyclo[3.2.0]heptane-3-carboxylate;hydrochloride |
| InChIKey | CTVDRVRVOABUPB-WLYNEOFISA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CN[C@H]2C1.Cl |
Computed by PubChem (NCBI)