CAS 2231674-95-4 appears in our catalog under these names: tert-Butyl 2,5-diazabicyclo[4.1.0]heptane-2-carboxylate hydrochloride, 95%, tert-Butyl 2,5-diazabicyclo[4.1.0]heptane-2-carboxylate hydrochloride 97%, tert-Butyl 2,5-diazabicyclo[4.1.0]heptane-2-carboxylate hydrochloride, 97%, 97%, tert-Butyl 2,5-diazabicyclo[4.1.0]heptane-2-carboxylate hydrochloride, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 100mg, 250mg.
Tert-butyl 2,5-diazabicyclo[4.1.0]heptane-2-carboxylate;hydrochloride (CAS 2231674-95-4) is a chemical compound with the molecular formula C10H19ClN2O2 and a molecular weight of 234.72 g/mol. IUPAC name: tert-butyl 2,5-diazabicyclo[4.1.0]heptane-2-carboxylate;hydrochloride. InChIKey: SBYXNRSIURNDCT-UHFFFAOYSA-N.
| Molecular formula | C10H19ClN2O2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | tert-butyl 2,5-diazabicyclo[4.1.0]heptane-2-carboxylate;hydrochloride |
| InChIKey | SBYXNRSIURNDCT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC2C1C2.Cl |
Computed by PubChem (NCBI)