CAS 1269437-74-2 appears in our catalog under these names: (1R,4R)-tert-Butyl 2,5-diazabicyclo[2.2.1]heptane-2-carboxylate hydrochloride, 97%, (1R,4R)-tert-Butyl 2,5-diazabicyclo(2.2.1)heptane-2-carboxylate hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 5g, 0,05g, 0,1g, 0,25g, 0,5g.
Tert-butyl (1R,4R)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate;hydrochloride (CAS 1269437-74-2) is a chemical compound with the molecular formula C10H19ClN2O2 and a molecular weight of 234.72 g/mol. IUPAC name: tert-butyl (1R,4R)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate;hydrochloride. InChIKey: XFBFNTNDFXDYEC-SCLLHFNJSA-N.
| Molecular formula | C10H19ClN2O2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | tert-butyl (1R,4R)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate;hydrochloride |
| InChIKey | XFBFNTNDFXDYEC-SCLLHFNJSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@H]1CN2.Cl |
Computed by PubChem (NCBI)