cas: 189940-04-3 — see every product listed under this CAS number, including other names
6-(trifluoromethyl)-2H-1,4-benzoxazin-3(4H)-one, 98%, 98% (CAS 189940-04-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AYAD-100mg |
| cas | 189940-04-3 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 1g | 674.00 Pln | |
| Chemat | 5g | 3030.80 Pln | |
| Chemat | 10g | 3333.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one (CAS 189940-04-3) is a chemical compound with the molecular formula C9H6F3NO2 and a molecular weight of 217.14 g/mol. IUPAC name: 6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one. InChIKey: LRZVYXWBGNCLDB-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO2 |
|---|---|
| Molecular weight | 217.14 g/mol |
| IUPAC name | 6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one |
| InChIKey | LRZVYXWBGNCLDB-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)