Products 918525-00-5
CAS 918525-00-5 is the registry number for 1-(Trifluoromethyl)-3-isocyanato-5-methoxybenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 500mg.
1-isocyanato-3-methoxy-5-(trifluoromethyl)benzene (CAS 918525-00-5) is a chemical compound with the molecular formula C9H6F3NO2 and a molecular weight of 217.14 g/mol. IUPAC name: 1-isocyanato-3-methoxy-5-(trifluoromethyl)benzene. InChIKey: QBSACYPSHGFHBX-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO2 |
|---|---|
| Molecular weight | 217.14 g/mol |
| IUPAC name | 1-isocyanato-3-methoxy-5-(trifluoromethyl)benzene |
| InChIKey | QBSACYPSHGFHBX-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)N=C=O)C(F)(F)F |
Computed by PubChem (NCBI)