Products 951883-90-2
CAS 951883-90-2 is the registry number for 1-Hydroxy-6-(trifluoromethyl)oxindoline, 98%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-hydroxy-6-(trifluoromethyl)-3H-indol-2-one (CAS 951883-90-2) is a chemical compound with the molecular formula C9H6F3NO2 and a molecular weight of 217.14 g/mol. IUPAC name: 1-hydroxy-6-(trifluoromethyl)-3H-indol-2-one. InChIKey: MOKZZJNBZAQOTP-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO2 |
|---|---|
| Molecular weight | 217.14 g/mol |
| IUPAC name | 1-hydroxy-6-(trifluoromethyl)-3H-indol-2-one |
| InChIKey | MOKZZJNBZAQOTP-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)C(F)(F)F)N(C1=O)O |
Computed by PubChem (NCBI)