CAS 399-06-4 appears in our catalog under these names: 4,4,4-Trifluoro-1-(pyridine-4-yl)butane-1,3-dione, 95%, 4,4,4-Trifluoro-1-(pyridin-4-yl)butane-1,3-dione, 97%, 97%, 4,4,4-Trifluoro-1-(pyridine-4-yl)-1,3-butanedione, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 2.5g, 10g.
4,4,4-trifluoro-1-pyridin-4-ylbutane-1,3-dione (CAS 399-06-4) is a chemical compound with the molecular formula C9H6F3NO2 and a molecular weight of 217.14 g/mol. IUPAC name: 4,4,4-trifluoro-1-pyridin-4-ylbutane-1,3-dione. InChIKey: VVFWWIMDNOGGLM-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO2 |
|---|---|
| Molecular weight | 217.14 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-pyridin-4-ylbutane-1,3-dione |
| InChIKey | VVFWWIMDNOGGLM-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)