cas: 109966-30-5 — see every product listed under this CAS number, including other names
6-Benzyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine 98% (CAS 109966-30-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A116151-250mg |
| cas | 109966-30-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A116151 |
6-benzyl-5,7-dihydropyrrolo[3,4-b]pyridine (CAS 109966-30-5) is a chemical compound with the molecular formula C14H14N2 and a molecular weight of 210.27 g/mol. IUPAC name: 6-benzyl-5,7-dihydropyrrolo[3,4-b]pyridine. InChIKey: DNVMWHGYSCHZGW-UHFFFAOYSA-N.
| Molecular formula | C14H14N2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 6-benzyl-5,7-dihydropyrrolo[3,4-b]pyridine |
| InChIKey | DNVMWHGYSCHZGW-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1CC3=CC=CC=C3)N=CC=C2 |
Computed by PubChem (NCBI)