cas: 109966-30-5 — see every product listed under this CAS number, including other names
6-Benzyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine (CAS 109966-30-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093054-1G |
| cas | 109966-30-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 857.01 Pln | |
| Fluorochem | 5g | 3074.98 Pln |
| delivery time | 3-4 weeks |
|---|
6-benzyl-5,7-dihydropyrrolo[3,4-b]pyridine (CAS 109966-30-5) is a chemical compound with the molecular formula C14H14N2 and a molecular weight of 210.27 g/mol. IUPAC name: 6-benzyl-5,7-dihydropyrrolo[3,4-b]pyridine. InChIKey: DNVMWHGYSCHZGW-UHFFFAOYSA-N.
| Molecular formula | C14H14N2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 6-benzyl-5,7-dihydropyrrolo[3,4-b]pyridine |
| InChIKey | DNVMWHGYSCHZGW-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1CC3=CC=CC=C3)N=CC=C2 |
Computed by PubChem (NCBI)