cas: 72754-05-3 — see every product listed under this CAS number, including other names
6-Bromo-1,8-naphthyridin-2-ol 97% (CAS 72754-05-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A237242-250mg |
| cas | 72754-05-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 592.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A237242 |
6-bromo-1H-1,8-naphthyridin-2-one (CAS 72754-05-3) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 6-bromo-1H-1,8-naphthyridin-2-one. InChIKey: BCEWGGGNOQNYKK-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 6-bromo-1H-1,8-naphthyridin-2-one |
| InChIKey | BCEWGGGNOQNYKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=NC=C(C=C21)Br |
Computed by PubChem (NCBI)