cas: 66361-67-9 — see every product listed under this CAS number, including other names
6-Bromo-1-Tetralone, 98%, 98% (CAS 66361-67-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FA7H-100mg |
| cas | 66361-67-9 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 448.40 Pln | |
| Chemat | 10g | 669.20 Pln | |
| Chemat | 25g | 1302.80 Pln | |
| Chemat | 50g | 2267.60 Pln | |
| Chemat | 100g | 4197.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-bromo-3,4-dihydro-2H-naphthalen-1-one (CAS 66361-67-9) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: 6-bromo-3,4-dihydro-2H-naphthalen-1-one. InChIKey: OSDHOOBPMBLALZ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 6-bromo-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | OSDHOOBPMBLALZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Br)C(=O)C1 |
Computed by PubChem (NCBI)