cas: 1612172-53-8 — see every product listed under this CAS number, including other names
6-Bromo-1-isopropyl-2-methyl-1H-imidazo[4,5-c]pyridine, 95%, 95% (CAS 1612172-53-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120F2B-100mg |
| cas | 1612172-53-8 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 424.40 Pln | |
| Chemat | 1g | 808.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2-methyl-1-propan-2-ylimidazo[4,5-c]pyridine (CAS 1612172-53-8) is a chemical compound with the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. IUPAC name: 6-bromo-2-methyl-1-propan-2-ylimidazo[4,5-c]pyridine. InChIKey: PSXCLSJZWMAUFE-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN3 |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | 6-bromo-2-methyl-1-propan-2-ylimidazo[4,5-c]pyridine |
| InChIKey | PSXCLSJZWMAUFE-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CN=C(C=C2N1C(C)C)Br |
Computed by PubChem (NCBI)