cas: 309965-30-8 — see every product listed under this CAS number, including other names
6-Bromo-3-methyl-3,4-dihydro-2H-benzo[e][1,3]oxazin-2-one, 95%, 95% (CAS 309965-30-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KKC8-100mg |
| cas | 309965-30-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 650.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-bromo-3-methyl-4H-1,3-benzoxazin-2-one (CAS 309965-30-8) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 6-bromo-3-methyl-4H-1,3-benzoxazin-2-one. InChIKey: RDZNJVWTLNPLDB-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 6-bromo-3-methyl-4H-1,3-benzoxazin-2-one |
| InChIKey | RDZNJVWTLNPLDB-UHFFFAOYSA-N |
| SMILES | CN1CC2=C(C=CC(=C2)Br)OC1=O |
Computed by PubChem (NCBI)