cas: 23976-54-7 — see every product listed under this CAS number, including other names
6-Bromo-4-(bromomethyl)quinolin-2(1H)-one, 95% (CAS 23976-54-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1040346-5g |
| cas | 23976-54-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 9483.46 Pln | |
| AmBeed | 250mg | 1274.35 Pln | |
| AmBeed | 1g | 3311.98 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-bromo-4-(bromomethyl)-1H-quinolin-2-one (CAS 23976-54-7) is a chemical compound with the molecular formula C10H7Br2NO and a molecular weight of 316.98 g/mol. IUPAC name: 6-bromo-4-(bromomethyl)-1H-quinolin-2-one. InChIKey: WTKKGOSTKQBFQA-UHFFFAOYSA-N.
| Molecular formula | C10H7Br2NO |
|---|---|
| Molecular weight | 316.98 g/mol |
| IUPAC name | 6-bromo-4-(bromomethyl)-1H-quinolin-2-one |
| InChIKey | WTKKGOSTKQBFQA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CC(=O)N2)CBr |
Computed by PubChem (NCBI)