cas: 24036-47-3 — see every product listed under this CAS number, including other names
6-Bromo-4-methyl-2H-benzo[b][1,4]oxazin-3(4H)-one, 97%, 97% (CAS 24036-47-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BDXS-100mg |
| cas | 24036-47-3 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 707.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-bromo-4-methyl-1,4-benzoxazin-3-one (CAS 24036-47-3) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 6-bromo-4-methyl-1,4-benzoxazin-3-one. InChIKey: PXVXLTXGIDUXBH-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 6-bromo-4-methyl-1,4-benzoxazin-3-one |
| InChIKey | PXVXLTXGIDUXBH-UHFFFAOYSA-N |
| SMILES | CN1C(=O)COC2=C1C=C(C=C2)Br |
Computed by PubChem (NCBI)