cas: 1500190-82-8 — see every product listed under this CAS number, including other names
6-Bromo-8-methylimidazo[1,2-a]pyridin-2-amine, 97%, 97% (CAS 1500190-82-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DF7R-100mg |
| cas | 1500190-82-8 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 1010.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-bromo-8-methylimidazo[1,2-a]pyridin-2-amine (CAS 1500190-82-8) is a chemical compound with the molecular formula C8H8BrN3 and a molecular weight of 226.07 g/mol. IUPAC name: 6-bromo-8-methylimidazo[1,2-a]pyridin-2-amine. InChIKey: HNXIVIKEZUQSSO-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 6-bromo-8-methylimidazo[1,2-a]pyridin-2-amine |
| InChIKey | HNXIVIKEZUQSSO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN2C1=NC(=C2)N)Br |
Computed by PubChem (NCBI)