cas: 49660-57-3 — see every product listed under this CAS number, including other names
6-Bromochroman-4-one 97% (CAS 49660-57-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A307269-250mg |
| cas | 49660-57-3 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 186.81 Pln | |
| Ambeed | 100g | 487.19 Pln | |
| Ambeed | 500g | 1877.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A307269 |
6-bromo-2,3-dihydrochromen-4-one (CAS 49660-57-3) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: 6-bromo-2,3-dihydrochromen-4-one. InChIKey: PFLPVOXSUCCZDH-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | 6-bromo-2,3-dihydrochromen-4-one |
| InChIKey | PFLPVOXSUCCZDH-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)