CAS 49660-57-3 appears in our catalog under these names: 6–Bromo–4–chromanone, 6-Bromo-4-chromanone, >98.0%(GC), 6-Bromochroman-4-one 97%, 6-Bromo-4-chromanone, 97%, 97%, 6-Bromochroman-4-one, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250mg, 10g, 100g, 500g.
6-bromo-2,3-dihydrochromen-4-one (CAS 49660-57-3) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: 6-bromo-2,3-dihydrochromen-4-one. InChIKey: PFLPVOXSUCCZDH-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | 6-bromo-2,3-dihydrochromen-4-one |
| InChIKey | PFLPVOXSUCCZDH-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)