cas: 1256478-41-7 — see every product listed under this CAS number, including other names
6-Chloro-2-(chloromethyl)thiazolo(5,4-b)pyridine, 98% (CAS 1256478-41-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A623545-1g |
| cas | 1256478-41-7 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 12764.50 Pln | |
| AmBeed | 250mg | 5147.80 Pln | |
| AmBeed | 5g | 23284.66 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-chloro-2-(chloromethyl)-[1,3]thiazolo[5,4-b]pyridine (CAS 1256478-41-7) is a chemical compound with the molecular formula C7H4Cl2N2S and a molecular weight of 219.09 g/mol. IUPAC name: 6-chloro-2-(chloromethyl)-[1,3]thiazolo[5,4-b]pyridine. InChIKey: YPBUNWSZSDVNHI-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2S |
|---|---|
| Molecular weight | 219.09 g/mol |
| IUPAC name | 6-chloro-2-(chloromethyl)-[1,3]thiazolo[5,4-b]pyridine |
| InChIKey | YPBUNWSZSDVNHI-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1N=C(S2)CCl)Cl |
Computed by PubChem (NCBI)