6-Chloro-2-methoxy-9H-carbazole, 95%
cas: 372478-27-8 — see every product listed under this CAS number, including other names
6-Chloro-2-methoxy-9H-carbazole, 95% (CAS 372478-27-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1966582-1g |
| cas | 372478-27-8 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 448.25 Pln | |
| Ambeed | 10g | 631.81 Pln | |
| Ambeed | 25g | 1143.56 Pln | |
| Ambeed | 100g | 3251.75 Pln | |
| BLDpharm | 1g | 214.39 Pln | |
| BLDpharm | 5g | 475.41 Pln | |
| BLDpharm | 10g | 675.34 Pln | |
| BLDpharm | 25g | 1230.70 Pln | |
| BLDpharm | 100g | 3496.57 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 218.00 Pln | |
| Chemat | 10g | 371.60 Pln | |
| Chemat | 25g | 726.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
6-chloro-2-methoxy-9H-carbazole (CAS 372478-27-8) is a chemical compound with the molecular formula C13H10ClNO and a molecular weight of 231.68 g/mol. IUPAC name: 6-chloro-2-methoxy-9H-carbazole. InChIKey: LJTUYPCDZSHRKS-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | 6-chloro-2-methoxy-9H-carbazole |
| InChIKey | LJTUYPCDZSHRKS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3=C(N2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)