CAS 372478-27-8 appears in our catalog under these names: 6-Chloro-2-methoxy-9H-carbazole 95%, 6-Chloro-2-methoxy-9H-carbazole, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g.
6-chloro-2-methoxy-9H-carbazole (CAS 372478-27-8) is a chemical compound with the molecular formula C13H10ClNO and a molecular weight of 231.68 g/mol. IUPAC name: 6-chloro-2-methoxy-9H-carbazole. InChIKey: LJTUYPCDZSHRKS-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | 6-chloro-2-methoxy-9H-carbazole |
| InChIKey | LJTUYPCDZSHRKS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3=C(N2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)