6-Chloro-2-phenyl-1H-indole, 95%
cas: 57039-63-1 — see every product listed under this CAS number, including other names
6-Chloro-2-phenyl-1H-indole, 95% (CAS 57039-63-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A324316-100mg |
| cas | 57039-63-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 403.75 Pln | |
| Ambeed | 250mg | 665.19 Pln | |
| Ambeed | 1g | 1660.88 Pln | |
| Chemat | 100mg | 453.20 Pln | |
| Chemat | 250mg | 726.80 Pln | |
| Chemat | 1g | 1850.00 Pln | |
| BLDpharm | 100mg | 430.98 Pln | |
| BLDpharm | 250mg | 708.66 Pln | |
| BLDpharm | 1g | 1786.06 Pln | |
| Fluorochem | 100mg | 825.77 Pln | |
| Fluorochem | 250mg | 1341.21 Pln | |
| Fluorochem | 1g | 3418.61 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-chloro-2-phenyl-1H-indole (CAS 57039-63-1) is a chemical compound with the molecular formula C14H10ClN and a molecular weight of 227.69 g/mol. IUPAC name: 6-chloro-2-phenyl-1H-indole. InChIKey: OBCVUTCTTKCQRR-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 6-chloro-2-phenyl-1H-indole |
| InChIKey | OBCVUTCTTKCQRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(N2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)