CAS 4998-12-3 is the registry number for Epinastine Impurity A. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-11H-benzo[c][1]benzazepine (CAS 4998-12-3) is a chemical compound with the molecular formula C14H10ClN and a molecular weight of 227.69 g/mol. IUPAC name: 6-chloro-11H-benzo[c][1]benzazepine. InChIKey: HUUMDMKRGBTFIZ-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 6-chloro-11H-benzo[c][1]benzazepine |
| InChIKey | HUUMDMKRGBTFIZ-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(=NC3=CC=CC=C31)Cl |
Computed by PubChem (NCBI)