CAS 7496-73-3 is the registry number for 2-(4-Chlorophenyl)indolizine. Offered by: TRC. Available pack sizes: 500mg.
2-(4-chlorophenyl)indolizine (CAS 7496-73-3) is a chemical compound with the molecular formula C14H10ClN and a molecular weight of 227.69 g/mol. IUPAC name: 2-(4-chlorophenyl)indolizine. InChIKey: JUFKIZACGBFMPH-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 2-(4-chlorophenyl)indolizine |
| InChIKey | JUFKIZACGBFMPH-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN2C=C1)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)