cas: 4887-91-6 — see every product listed under this CAS number, including other names
6-Chloro-2-propyl-1H-benzo[d]imidazole 95% (CAS 4887-91-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A338842-1g |
| cas | 4887-91-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 559.50 Pln | |
| Ambeed | 5g | 1861.13 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A338842 |
6-chloro-2-propyl-1H-benzimidazole (CAS 4887-91-6) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: 6-chloro-2-propyl-1H-benzimidazole. InChIKey: OIIZPYFXIHFYQR-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 6-chloro-2-propyl-1H-benzimidazole |
| InChIKey | OIIZPYFXIHFYQR-UHFFFAOYSA-N |
| SMILES | CCCC1=NC2=C(N1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)