cas: 1190309-92-2 — see every product listed under this CAS number, including other names
6-Chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine, 95%, 95% (CAS 1190309-92-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111P57-100mg |
| cas | 1190309-92-2 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 717.20 Pln | |
| Chemat | 1g | 1763.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine (CAS 1190309-92-2) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 6-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine. InChIKey: LHSQYXDNGXWWTK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 6-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | LHSQYXDNGXWWTK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=CN2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)