6-Chloro-5-fluoropyridine-3-sulfonyl chloride, 95%
cas: 1261737-06-7 — see every product listed under this CAS number, including other names
6-Chloro-5-fluoropyridine-3-sulfonyl chloride, 95% (CAS 1261737-06-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1062400-250mg |
| cas | 1261737-06-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1193.62 Pln | |
| Ambeed | 1g | 2333.94 Pln | |
| Ambeed | 5g | 9131.31 Pln | |
| Chemat | 100mg | 592.40 Pln | |
| Chemat | 250mg | 962.00 Pln | |
| Chemat | 1g | 2498.00 Pln | |
| BLDpharm | 100mg | 858.61 Pln | |
| BLDpharm | 250mg | 1397.31 Pln | |
| BLDpharm | 1g | 2513.58 Pln | |
| BLDpharm | 5g | 9838.78 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
6-chloro-5-fluoropyridine-3-sulfonyl chloride (CAS 1261737-06-7) is a chemical compound with the molecular formula C5H2Cl2FNO2S and a molecular weight of 230.04 g/mol. IUPAC name: 6-chloro-5-fluoropyridine-3-sulfonyl chloride. InChIKey: BTIFOCMOVIICLA-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2FNO2S |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 6-chloro-5-fluoropyridine-3-sulfonyl chloride |
| InChIKey | BTIFOCMOVIICLA-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1F)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)