Products 1261737-06-7

CAS 1261737-06-7 appears in our catalog under these names: 6-Chloro-5-fluoropyridine-3-sulfonyl chloride, 6-Chloro-5-fluoropyridine-3-sulfonyl chloride, 95%, 95%, 6-Chloro-5-fluoropyridine-3-sulfonyl chloride, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,25g, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

6-chloro-5-fluoropyridine-3-sulfonyl chloride (CAS 1261737-06-7) is a chemical compound with the molecular formula C5H2Cl2FNO2S and a molecular weight of 230.04 g/mol. IUPAC name: 6-chloro-5-fluoropyridine-3-sulfonyl chloride. InChIKey: BTIFOCMOVIICLA-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2Cl2FNO2S
Molecular weight230.04 g/mol
IUPAC name6-chloro-5-fluoropyridine-3-sulfonyl chloride
InChIKeyBTIFOCMOVIICLA-UHFFFAOYSA-N
SMILESC1=C(C=NC(=C1F)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)