Products 1934395-48-8
CAS 1934395-48-8 is the registry number for 3,5-Dichloropyridine-2-sulfonyl Fluoride, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 5g.
3,5-dichloropyridine-2-sulfonyl fluoride (CAS 1934395-48-8) is a chemical compound with the molecular formula C5H2Cl2FNO2S and a molecular weight of 230.04 g/mol. IUPAC name: 3,5-dichloropyridine-2-sulfonyl fluoride. InChIKey: OJBWJLXXWMCQGA-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2FNO2S |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 3,5-dichloropyridine-2-sulfonyl fluoride |
| InChIKey | OJBWJLXXWMCQGA-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)S(=O)(=O)F)Cl |
Computed by PubChem (NCBI)