Products 1803567-06-7

CAS 1803567-06-7 appears in our catalog under these names: 2-Chloro-4-fluoropyridine-3-sulfonyl chloride, 95%, 2-Chloro-4-fluoropyridine-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2-chloro-4-fluoropyridine-3-sulfonyl chloride (CAS 1803567-06-7) is a chemical compound with the molecular formula C5H2Cl2FNO2S and a molecular weight of 230.04 g/mol. IUPAC name: 2-chloro-4-fluoropyridine-3-sulfonyl chloride. InChIKey: UVHYZABLGKWKFR-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2Cl2FNO2S
Molecular weight230.04 g/mol
IUPAC name2-chloro-4-fluoropyridine-3-sulfonyl chloride
InChIKeyUVHYZABLGKWKFR-UHFFFAOYSA-N
SMILESC1=CN=C(C(=C1F)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)