Products 1261843-23-5

CAS 1261843-23-5 is the registry number for 2-Chloro-6-fluoropyridine-4-sulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-chloro-6-fluoropyridine-4-sulfonyl chloride (CAS 1261843-23-5) is a chemical compound with the molecular formula C5H2Cl2FNO2S and a molecular weight of 230.04 g/mol. IUPAC name: 2-chloro-6-fluoropyridine-4-sulfonyl chloride. InChIKey: NUUYQATWHKBYIR-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2Cl2FNO2S
Molecular weight230.04 g/mol
IUPAC name2-chloro-6-fluoropyridine-4-sulfonyl chloride
InChIKeyNUUYQATWHKBYIR-UHFFFAOYSA-N
SMILESC1=C(C=C(N=C1F)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)