CAS 1261737-23-8 appears in our catalog under these names: 5-Chloro-3-fluoropyridine-2-sulfonyl chloride, 95%, 5-Chloro-3-fluoropyridine-2-sulfonyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
5-chloro-3-fluoropyridine-2-sulfonyl chloride (CAS 1261737-23-8) is a chemical compound with the molecular formula C5H2Cl2FNO2S and a molecular weight of 230.04 g/mol. IUPAC name: 5-chloro-3-fluoropyridine-2-sulfonyl chloride. InChIKey: MMTYCRCZGDSGHR-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2FNO2S |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 5-chloro-3-fluoropyridine-2-sulfonyl chloride |
| InChIKey | MMTYCRCZGDSGHR-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1F)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)