CAS 2173999-42-1 is the registry number for 3,5-Dichloropyridine-4-sulfonyl fluoride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3,5-dichloropyridine-4-sulfonyl fluoride (CAS 2173999-42-1) is a chemical compound with the molecular formula C5H2Cl2FNO2S and a molecular weight of 230.04 g/mol. IUPAC name: 3,5-dichloropyridine-4-sulfonyl fluoride. InChIKey: KIRBQDFDBMEMSK-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2FNO2S |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 3,5-dichloropyridine-4-sulfonyl fluoride |
| InChIKey | KIRBQDFDBMEMSK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Cl)S(=O)(=O)F)Cl |
Computed by PubChem (NCBI)