6-Chloro-5-nitro-1H-indazole, 98%
cas: 101420-98-8 — see every product listed under this CAS number, including other names
6-Chloro-5-nitro-1H-indazole, 98% (CAS 101420-98-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 500g, 100mg, 10g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A334100-250mg |
| cas | 101420-98-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 25g | 437.12 Pln | |
| Ambeed | 100g | 1505.12 Pln | |
| Ambeed | 500g | 5804.94 Pln | |
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 141.20 Pln | |
| Chemat | 25g | 237.20 Pln | |
| Chemat | 50g | 405.20 Pln | |
| Chemat | 100g | 736.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
6-chloro-5-nitro-1H-indazole (CAS 101420-98-8) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 6-chloro-5-nitro-1H-indazole. InChIKey: SXVCMKGCWGVSSX-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 6-chloro-5-nitro-1H-indazole |
| InChIKey | SXVCMKGCWGVSSX-UHFFFAOYSA-N |
| SMILES | C1=C2C=NNC2=CC(=C1[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)