cas: 194163-31-0 — see every product listed under this CAS number, including other names
6-Cyano-1H-indazole-3-carboxylic acid, 95% (CAS 194163-31-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 50mg, 500mg, 1g, 5g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A816492-100mg |
| cas | 194163-31-0 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 832.06 Pln | |
| Ambeed | 250mg | 1610.81 Pln | |
| Chemat | 50mg | 525.20 Pln | |
| Chemat | 100mg | 554.00 Pln | |
| Chemat | 250mg | 1048.40 Pln | |
| Chemat | 500mg | 1538.00 Pln | |
| Chemat | 1g | 2522.00 Pln | |
| Chemat | 5g | 7442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-cyano-1H-indazole-3-carboxylic acid (CAS 194163-31-0) is a chemical compound with the molecular formula C9H5N3O2 and a molecular weight of 187.15 g/mol. IUPAC name: 6-cyano-1H-indazole-3-carboxylic acid. InChIKey: VVBNYLSPDQSTIM-UHFFFAOYSA-N.
| Molecular formula | C9H5N3O2 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | 6-cyano-1H-indazole-3-carboxylic acid |
| InChIKey | VVBNYLSPDQSTIM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)NN=C2C(=O)O |
Computed by PubChem (NCBI)