Products 1207725-95-8

CAS 1207725-95-8 is the registry number for 5-Cyano-1H-benzo[d]imidazole-2-carboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

6-cyano-1H-benzimidazole-2-carboxylic acid (CAS 1207725-95-8) is a chemical compound with the molecular formula C9H5N3O2 and a molecular weight of 187.15 g/mol. IUPAC name: 6-cyano-1H-benzimidazole-2-carboxylic acid. InChIKey: BVHHTDXFMXBIJX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5N3O2
Molecular weight187.15 g/mol
IUPAC name6-cyano-1H-benzimidazole-2-carboxylic acid
InChIKeyBVHHTDXFMXBIJX-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1C#N)NC(=N2)C(=O)O

Computed by PubChem (NCBI)