CAS 371944-18-2 is the registry number for Pyrido[3',2':4,5]furo[3,2-d]pyrimidin-4(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (CAS 371944-18-2) is a chemical compound with the molecular formula C9H5N3O2 and a molecular weight of 187.15 g/mol. IUPAC name: 8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one. InChIKey: RRSDKRUGCHBECF-UHFFFAOYSA-N.
| Molecular formula | C9H5N3O2 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | 8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| InChIKey | RRSDKRUGCHBECF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)OC3=C2N=CNC3=O |
Computed by PubChem (NCBI)