CAS 194163-31-0 appears in our catalog under these names: 6-Cyano-1H-indazole-3-carboxylic acid, 97%, 6-Cyano-1H-indazole-3-carboxylic acid, 6-Cyano-1H-indazole-3-carboxylic acid 95%, 6-Cyano-1H-indazole-3-carboxylic acid, 95%, 95%, 6-Cyano-1H-indazole-3-carboxylic acid, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 50mg, 0,5g, 100mg, 250mg, 1g, 500mg.
6-cyano-1H-indazole-3-carboxylic acid (CAS 194163-31-0) is a chemical compound with the molecular formula C9H5N3O2 and a molecular weight of 187.15 g/mol. IUPAC name: 6-cyano-1H-indazole-3-carboxylic acid. InChIKey: VVBNYLSPDQSTIM-UHFFFAOYSA-N.
| Molecular formula | C9H5N3O2 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | 6-cyano-1H-indazole-3-carboxylic acid |
| InChIKey | VVBNYLSPDQSTIM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)NN=C2C(=O)O |
Computed by PubChem (NCBI)