CAS 1020035-67-9 is the registry number for 6-Cyanoimidazo(1,2-a)pyridine-2-carboxylic acid, 98+%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 10g, 100mg.
6-cyanoimidazo[1,2-a]pyridine-2-carboxylic acid (CAS 1020035-67-9) is a chemical compound with the molecular formula C9H5N3O2 and a molecular weight of 187.15 g/mol. IUPAC name: 6-cyanoimidazo[1,2-a]pyridine-2-carboxylic acid. InChIKey: CVFNVXPJVITGNO-UHFFFAOYSA-N.
| Molecular formula | C9H5N3O2 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | 6-cyanoimidazo[1,2-a]pyridine-2-carboxylic acid |
| InChIKey | CVFNVXPJVITGNO-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1C#N)C(=O)O |
Computed by PubChem (NCBI)