CAS 1000341-33-2 appears in our catalog under these names: 4-cyano-1H-indazole-3-carboxylic acid, 97%, 4-Cyano-1H-indazole-3-carboxylic acid, 4-cyano-1H-indazole-3-carboxylic acid, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 1g, 250mg, 500mg.
4-cyano-1H-indazole-3-carboxylic acid (CAS 1000341-33-2) is a chemical compound with the molecular formula C9H5N3O2 and a molecular weight of 187.15 g/mol. IUPAC name: 4-cyano-1H-indazole-3-carboxylic acid. InChIKey: XTNCDNOZENBPPA-UHFFFAOYSA-N.
| Molecular formula | C9H5N3O2 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | 4-cyano-1H-indazole-3-carboxylic acid |
| InChIKey | XTNCDNOZENBPPA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NN=C2C(=O)O)C#N |
Computed by PubChem (NCBI)