cas: 1079992-96-3 — see every product listed under this CAS number, including other names
6-FLUORO-2-METHYL-3-NITROBENZOIC ACID, 98% (CAS 1079992-96-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F499927-100MG |
| cas | 1079992-96-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 500mg | 653.95 Pln | |
| Fluorochem | 1g | 872.63 Pln | |
| Fluorochem | 5g | 2736.55 Pln | |
| Fluorochem | 10g | 5423.11 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-fluoro-2-methyl-3-nitrobenzoic acid (CAS 1079992-96-3) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 6-fluoro-2-methyl-3-nitrobenzoic acid. InChIKey: DEPIFWRMRCNBGQ-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 6-fluoro-2-methyl-3-nitrobenzoic acid |
| InChIKey | DEPIFWRMRCNBGQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C(=O)O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)