cas: 716-03-0 — see every product listed under this CAS number, including other names
6-Fluoro-2-methyl-4-quinolinecarboxylic acid, 97% (CAS 716-03-0) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | MO01209CB |
| cas | 716-03-0 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 227.05 Pln | |
| Thermo Scientific | 1g | 621.08 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
6-fluoro-2-methylquinoline-4-carboxylic acid (CAS 716-03-0) is a chemical compound with the molecular formula C11H8FNO2 and a molecular weight of 205.18 g/mol. IUPAC name: 6-fluoro-2-methylquinoline-4-carboxylic acid. InChIKey: KXMSETXWKPJCQS-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO2 |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 6-fluoro-2-methylquinoline-4-carboxylic acid |
| InChIKey | KXMSETXWKPJCQS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C=CC2=N1)F)C(=O)O |
Computed by PubChem (NCBI)