cas: 716-03-0 — see every product listed under this CAS number, including other names
6-Fluoro-2-methylquinoline-4-carboxylic acid (CAS 716-03-0) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1175T6-5mg |
| cas | 716-03-0 |
| size | 5mg |
| availability | 0.025g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 194.00 Pln | |
| Chemat | 25mg | 352.40 Pln | |
| Fluorochem | 1g | 1549.47 Pln | |
| Fluorochem | 5g | 4423.46 Pln |
| delivery time | 3 weeks |
|---|
6-fluoro-2-methylquinoline-4-carboxylic acid (CAS 716-03-0) is a chemical compound with the molecular formula C11H8FNO2 and a molecular weight of 205.18 g/mol. IUPAC name: 6-fluoro-2-methylquinoline-4-carboxylic acid. InChIKey: KXMSETXWKPJCQS-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO2 |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 6-fluoro-2-methylquinoline-4-carboxylic acid |
| InChIKey | KXMSETXWKPJCQS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C=CC2=N1)F)C(=O)O |
Computed by PubChem (NCBI)