cas: 84659-98-3 — see every product listed under this CAS number, including other names
6-Hydroxy-2-phenylpyrimidine-4-carboxylic acid (CAS 84659-98-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115Q1M-1g |
| cas | 84659-98-3 |
| size | 1g |
| availability | 31.12g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 3654.80 Pln |
| delivery time | 3 weeks |
|---|
6-oxo-2-phenyl-1H-pyrimidine-4-carboxylic acid (CAS 84659-98-3) is a chemical compound with the molecular formula C11H8N2O3 and a molecular weight of 216.19 g/mol. IUPAC name: 6-oxo-2-phenyl-1H-pyrimidine-4-carboxylic acid. InChIKey: SNFPSSBYDIFPOX-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 6-oxo-2-phenyl-1H-pyrimidine-4-carboxylic acid |
| InChIKey | SNFPSSBYDIFPOX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CC(=O)N2)C(=O)O |
Computed by PubChem (NCBI)