CAS 227960-58-9 appears in our catalog under these names: 6-Iodo-3,4-dihydro-2H-1-benzopyran-2-carboxylic acid, 6-Iodochroman-2-carboxylic acid, 97%, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 2,5g, 250mg, 1g, 5g.
6-iodo-3,4-dihydro-2H-chromene-2-carboxylic acid (CAS 227960-58-9) is a chemical compound with the molecular formula C10H9IO3 and a molecular weight of 304.08 g/mol. IUPAC name: 6-iodo-3,4-dihydro-2H-chromene-2-carboxylic acid. InChIKey: KUUOJGIUGRFQCR-UHFFFAOYSA-N.
| Molecular formula | C10H9IO3 |
|---|---|
| Molecular weight | 304.08 g/mol |
| IUPAC name | 6-iodo-3,4-dihydro-2H-chromene-2-carboxylic acid |
| InChIKey | KUUOJGIUGRFQCR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)I)OC1C(=O)O |
Computed by PubChem (NCBI)